C10H8ClN3O2S — CID 166414706
N'-(2-chloroacetyl)-1,3-benzothiazole-2-carbohydrazide (PubChem CID 166414706) has the molecular formula C10H8ClN3O2S and a molecular weight of 269.71 g/mol. Its IUPAC name is N'-(2-chloroacetyl)-1,3-benzothiazole-2-carbohydrazide.
| Compound Name | N'-(2-chloroacetyl)-1,3-benzothiazole-2-carbohydrazide |
|---|---|
| PubChem CID | 166414706 |
| Molecular Formula | C10H8ClN3O2S |
| Molecular Weight | 269.71 g/mol |
| Exact Mass | 269.00 |
| IUPAC Name | N'-(2-chloroacetyl)-1,3-benzothiazole-2-carbohydrazide |
| SMILES | O=C(CCl)NNC(=O)c1nc2ccccc2s1 |
| InChI | InChI=1S/C10H8ClN3O2S/c11-5-8(15)13-14-9(16)10-12-6-3-1-2-4-7(6)17-10/h1-4H,5H2,(H,13,15)(H,14,16) |
| InChIKey | ZDTZVPQWGMIASU-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.71 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|