C14H11N3O3S2 — CID 125485508
N'-(benzenesulfonyl)-1,3-benzothiazole-2-carbohydrazide (PubChem CID 125485508) has the molecular formula C14H11N3O3S2 and a molecular weight of 333.39 g/mol. Its IUPAC name is N'-(benzenesulfonyl)-1,3-benzothiazole-2-carbohydrazide.
| Compound Name | N'-(benzenesulfonyl)-1,3-benzothiazole-2-carbohydrazide |
|---|---|
| PubChem CID | 125485508 |
| Molecular Formula | C14H11N3O3S2 |
| Molecular Weight | 333.39 g/mol |
| Exact Mass | 333.02 |
| IUPAC Name | N'-(benzenesulfonyl)-1,3-benzothiazole-2-carbohydrazide |
| SMILES | O=C(NNS(=O)(=O)c1ccccc1)c1nc2ccccc2s1 |
| InChI | InChI=1S/C14H11N3O3S2/c18-13(14-15-11-8-4-5-9-12(11)21-14)16-17-22(19,20)10-6-2-1-3-7-10/h1-9,17H,(H,16,18) |
| InChIKey | TXBDNDYNYKDYDP-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 88.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.39 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|