C23H18ClN3O3S2 — CID 165413100
(E)-2-(1,3-benzothiazol-2-yl)-3-(4-chlorophenyl)-N'-(4-methylphenyl)sulfonylprop-2-enehydrazide (PubChem CID 165413100) has the molecular formula C23H18ClN3O3S2 and a molecular weight of 484.00 g/mol. Its IUPAC name is (E)-2-(1,3-benzothiazol-2-yl)-3-(4-chlorophenyl)-N'-(4-methylphenyl)sulfonylprop-2-enehydrazide.
| Compound Name | (E)-2-(1,3-benzothiazol-2-yl)-3-(4-chlorophenyl)-N'-(4-methylphenyl)sulfonylprop-2-enehydrazide |
|---|---|
| PubChem CID | 165413100 |
| Molecular Formula | C23H18ClN3O3S2 |
| Molecular Weight | 484.00 g/mol |
| Exact Mass | 483.05 |
| IUPAC Name | (E)-2-(1,3-benzothiazol-2-yl)-3-(4-chlorophenyl)-N'-(4-methylphenyl)sulfonylprop-2-enehydrazide |
| SMILES | Cc1ccc(S(=O)(=O)NNC(=O)/C(=C\c2ccc(Cl)cc2)c2nc3ccccc3s2)cc1 |
| InChI | InChI=1S/C23H18ClN3O3S2/c1-15-6-12-18(13-7-15)32(29,30)27-26-22(28)19(14-16-8-10-17(24)11-9-16)23-25-20-4-2-3-5-21(20)31-23/h2-14,27H,1H3,(H,26,28)/b19-14+ |
| InChIKey | QLJZOZFZWFRERC-XMHGGMMESA-N |
| XLogP | 4.81 |
| TPSA | 88.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.00 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|