C18H14NO3S- — CID 135750834
(E)-4-(1,3-benzothiazol-2-yl)-5-(4-hydroxyphenyl)pent-4-enoate (PubChem CID 135750834) has the molecular formula C18H14NO3S- and a molecular weight of 324.38 g/mol. Its IUPAC name is (E)-4-(1,3-benzothiazol-2-yl)-5-(4-hydroxyphenyl)pent-4-enoate.
| Compound Name | (E)-4-(1,3-benzothiazol-2-yl)-5-(4-hydroxyphenyl)pent-4-enoate |
|---|---|
| PubChem CID | 135750834 |
| Molecular Formula | C18H14NO3S- |
| Molecular Weight | 324.38 g/mol |
| Exact Mass | 324.07 |
| IUPAC Name | (E)-4-(1,3-benzothiazol-2-yl)-5-(4-hydroxyphenyl)pent-4-enoate |
| SMILES | O=C([O-])CC/C(=C\c1ccc(O)cc1)c1nc2ccccc2s1 |
| InChI | InChI=1S/C18H15NO3S/c20-14-8-5-12(6-9-14)11-13(7-10-17(21)22)18-19-15-3-1-2-4-16(15)23-18/h1-6,8-9,11,20H,7,10H2,(H,21,22)/p-1/b13-11+ |
| InChIKey | ZIMPCNCOMCZQFD-ACCUITESSA-M |
| XLogP | 3.07 |
| TPSA | 73.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.38 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |