C18H13ClNO2S- — CID 7970798
(E)-4-(1,3-benzothiazol-2-yl)-5-(2-chlorophenyl)pent-4-enoate (PubChem CID 7970798) has the molecular formula C18H13ClNO2S- and a molecular weight of 342.83 g/mol. Its IUPAC name is (E)-4-(1,3-benzothiazol-2-yl)-5-(2-chlorophenyl)pent-4-enoate.
| Compound Name | (E)-4-(1,3-benzothiazol-2-yl)-5-(2-chlorophenyl)pent-4-enoate |
|---|---|
| PubChem CID | 7970798 |
| Molecular Formula | C18H13ClNO2S- |
| Molecular Weight | 342.83 g/mol |
| Exact Mass | 342.04 |
| IUPAC Name | (E)-4-(1,3-benzothiazol-2-yl)-5-(2-chlorophenyl)pent-4-enoate |
| SMILES | O=C([O-])CC/C(=C\c1ccccc1Cl)c1nc2ccccc2s1 |
| InChI | InChI=1S/C18H14ClNO2S/c19-14-6-2-1-5-12(14)11-13(9-10-17(21)22)18-20-15-7-3-4-8-16(15)23-18/h1-8,11H,9-10H2,(H,21,22)/p-1/b13-11+ |
| InChIKey | HSYFDTHJVYUOEP-ACCUITESSA-M |
| XLogP | 4.02 |
| TPSA | 53.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.83 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |