C22H16NO2S- — CID 7970844
(E)-4-(1,3-benzothiazol-2-yl)-5-naphthalen-2-ylpent-4-enoate (PubChem CID 7970844) has the molecular formula C22H16NO2S- and a molecular weight of 358.44 g/mol. Its IUPAC name is (E)-4-(1,3-benzothiazol-2-yl)-5-naphthalen-2-ylpent-4-enoate.
| Compound Name | (E)-4-(1,3-benzothiazol-2-yl)-5-naphthalen-2-ylpent-4-enoate |
|---|---|
| PubChem CID | 7970844 |
| Molecular Formula | C22H16NO2S- |
| Molecular Weight | 358.44 g/mol |
| Exact Mass | 358.09 |
| IUPAC Name | (E)-4-(1,3-benzothiazol-2-yl)-5-naphthalen-2-ylpent-4-enoate |
| SMILES | O=C([O-])CC/C(=C\c1ccc2ccccc2c1)c1nc2ccccc2s1 |
| InChI | InChI=1S/C22H17NO2S/c24-21(25)12-11-18(22-23-19-7-3-4-8-20(19)26-22)14-15-9-10-16-5-1-2-6-17(16)13-15/h1-10,13-14H,11-12H2,(H,24,25)/p-1/b18-14+ |
| InChIKey | YJIQDIFGIUHPTJ-NBVRZTHBSA-M |
| XLogP | 4.52 |
| TPSA | 53.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.44 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |