C19H16NO4S- — CID 7515766
(E)-3-(1,3-benzothiazol-2-yl)-4-(3,5-dimethoxyphenyl)but-3-enoate (PubChem CID 7515766) has the molecular formula C19H16NO4S- and a molecular weight of 354.41 g/mol. Its IUPAC name is (E)-3-(1,3-benzothiazol-2-yl)-4-(3,5-dimethoxyphenyl)but-3-enoate.
| Compound Name | (E)-3-(1,3-benzothiazol-2-yl)-4-(3,5-dimethoxyphenyl)but-3-enoate |
|---|---|
| PubChem CID | 7515766 |
| Molecular Formula | C19H16NO4S- |
| Molecular Weight | 354.41 g/mol |
| Exact Mass | 354.08 |
| IUPAC Name | (E)-3-(1,3-benzothiazol-2-yl)-4-(3,5-dimethoxyphenyl)but-3-enoate |
| SMILES | COc1cc(/C=C(\CC(=O)[O-])c2nc3ccccc3s2)cc(OC)c1 |
| InChI | InChI=1S/C19H17NO4S/c1-23-14-8-12(9-15(11-14)24-2)7-13(10-18(21)22)19-20-16-5-3-4-6-17(16)25-19/h3-9,11H,10H2,1-2H3,(H,21,22)/p-1/b13-7+ |
| InChIKey | LYAKMTRKURAEPO-NTUHNPAUSA-M |
| XLogP | 2.99 |
| TPSA | 71.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.41 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |