C17H11N2O4S- — CID 7062478
3-(1,3-benzothiazol-2-yl)-4-(4-nitrophenyl)but-3-enoate (PubChem CID 7062478) has the molecular formula C17H11N2O4S- and a molecular weight of 339.35 g/mol. Its IUPAC name is 3-(1,3-benzothiazol-2-yl)-4-(4-nitrophenyl)but-3-enoate.
| Compound Name | 3-(1,3-benzothiazol-2-yl)-4-(4-nitrophenyl)but-3-enoate |
|---|---|
| PubChem CID | 7062478 |
| Molecular Formula | C17H11N2O4S- |
| Molecular Weight | 339.35 g/mol |
| Exact Mass | 339.04 |
| IUPAC Name | 3-(1,3-benzothiazol-2-yl)-4-(4-nitrophenyl)but-3-enoate |
| SMILES | O=C([O-])CC(=Cc1ccc([N+](=O)[O-])cc1)c1nc2ccccc2s1 |
| InChI | InChI=1S/C17H12N2O4S/c20-16(21)10-12(9-11-5-7-13(8-6-11)19(22)23)17-18-14-3-1-2-4-15(14)24-17/h1-9H,10H2,(H,20,21)/p-1 |
| InChIKey | AOBCLBVGQRSELJ-UHFFFAOYSA-M |
| XLogP | 2.89 |
| TPSA | 96.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.35 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|