C17H11ClN2O4S — CID 8862754
(E)-3-(1,3-benzothiazol-2-yl)-4-(4-chloro-3-nitrophenyl)but-3-enoic acid (PubChem CID 8862754) has the molecular formula C17H11ClN2O4S and a molecular weight of 374.81 g/mol. Its IUPAC name is (E)-3-(1,3-benzothiazol-2-yl)-4-(4-chloro-3-nitrophenyl)but-3-enoic acid.
| Compound Name | (E)-3-(1,3-benzothiazol-2-yl)-4-(4-chloro-3-nitrophenyl)but-3-enoic acid |
|---|---|
| PubChem CID | 8862754 |
| Molecular Formula | C17H11ClN2O4S |
| Molecular Weight | 374.81 g/mol |
| Exact Mass | 374.01 |
| IUPAC Name | (E)-3-(1,3-benzothiazol-2-yl)-4-(4-chloro-3-nitrophenyl)but-3-enoic acid |
| SMILES | O=C(O)C/C(=C\c1ccc(Cl)c([N+](=O)[O-])c1)c1nc2ccccc2s1 |
| InChI | InChI=1S/C17H11ClN2O4S/c18-12-6-5-10(8-14(12)20(23)24)7-11(9-16(21)22)17-19-13-3-1-2-4-15(13)25-17/h1-8H,9H2,(H,21,22)/b11-7+ |
| InChIKey | VJMYHTHMFUYQDM-YRNVUSSQSA-N |
| XLogP | 4.87 |
| TPSA | 93.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.81 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|