C18H12Cl2NO2S- — CID 7873543
(E)-4-(1,3-benzothiazol-2-yl)-5-(3,4-dichlorophenyl)pent-4-enoate (PubChem CID 7873543) has the molecular formula C18H12Cl2NO2S- and a molecular weight of 377.27 g/mol. Its IUPAC name is (E)-4-(1,3-benzothiazol-2-yl)-5-(3,4-dichlorophenyl)pent-4-enoate.
| Compound Name | (E)-4-(1,3-benzothiazol-2-yl)-5-(3,4-dichlorophenyl)pent-4-enoate |
|---|---|
| PubChem CID | 7873543 |
| Molecular Formula | C18H12Cl2NO2S- |
| Molecular Weight | 377.27 g/mol |
| Exact Mass | 376.00 |
| IUPAC Name | (E)-4-(1,3-benzothiazol-2-yl)-5-(3,4-dichlorophenyl)pent-4-enoate |
| SMILES | O=C([O-])CC/C(=C\c1ccc(Cl)c(Cl)c1)c1nc2ccccc2s1 |
| InChI | InChI=1S/C18H13Cl2NO2S/c19-13-7-5-11(10-14(13)20)9-12(6-8-17(22)23)18-21-15-3-1-2-4-16(15)24-18/h1-5,7,9-10H,6,8H2,(H,22,23)/p-1/b12-9+ |
| InChIKey | NDZISIQKSMGZSK-FMIVXFBMSA-M |
| XLogP | 4.67 |
| TPSA | 53.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.27 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |