C21H20NO4S- — CID 7991436
(E)-4-(1,3-benzothiazol-2-yl)-5-(3-ethoxy-4-methoxyphenyl)pent-4-enoate (PubChem CID 7991436) has the molecular formula C21H20NO4S- and a molecular weight of 382.46 g/mol. Its IUPAC name is (E)-4-(1,3-benzothiazol-2-yl)-5-(3-ethoxy-4-methoxyphenyl)pent-4-enoate.
| Compound Name | (E)-4-(1,3-benzothiazol-2-yl)-5-(3-ethoxy-4-methoxyphenyl)pent-4-enoate |
|---|---|
| PubChem CID | 7991436 |
| Molecular Formula | C21H20NO4S- |
| Molecular Weight | 382.46 g/mol |
| Exact Mass | 382.11 |
| IUPAC Name | (E)-4-(1,3-benzothiazol-2-yl)-5-(3-ethoxy-4-methoxyphenyl)pent-4-enoate |
| SMILES | CCOc1cc(/C=C(\CCC(=O)[O-])c2nc3ccccc3s2)ccc1OC |
| InChI | InChI=1S/C21H21NO4S/c1-3-26-18-13-14(8-10-17(18)25-2)12-15(9-11-20(23)24)21-22-16-6-4-5-7-19(16)27-21/h4-8,10,12-13H,3,9,11H2,1-2H3,(H,23,24)/p-1/b15-12+ |
| InChIKey | OLQOFYZDOAKOAC-NTCAYCPXSA-M |
| XLogP | 3.77 |
| TPSA | 71.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.46 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |