About (Z)-4-(1,3-benzothiazol-2-yl)-5-(3-methoxy-4-propoxyphenyl)pent-4-enoic acid
(Z)-4-(1,3-benzothiazol-2-yl)-5-(3-methoxy-4-propoxyphenyl)pent-4-enoic acid (PubChem CID 92945343) has the molecular formula C22H23NO4S
and a molecular weight of 397.50 g/mol. Its IUPAC name is (Z)-4-(1,3-benzothiazol-2-yl)-5-(3-methoxy-4-propoxyphenyl)pent-4-enoic acid.
Molecular Properties
| Compound Name | (Z)-4-(1,3-benzothiazol-2-yl)-5-(3-methoxy-4-propoxyphenyl)pent-4-enoic acid |
| PubChem CID | 92945343 |
| Molecular Formula | C22H23NO4S |
| Molecular Weight | 397.50 g/mol |
| Exact Mass | 397.13 |
| IUPAC Name | (Z)-4-(1,3-benzothiazol-2-yl)-5-(3-methoxy-4-propoxyphenyl)pent-4-enoic acid |
| SMILES | CCCOc1ccc(/C=C(/CCC(=O)O)c2nc3ccccc3s2)cc1OC |
| InChI | InChI=1S/C22H23NO4S/c1-3-12-27-18-10-8-15(14-19(18)26-2)13-16(9-11-21(24)25)22-23-17-6-4-5-7-20(17)28-22/h4-8,10,13-14H,3,9,11-12H2,1-2H3,(H,24,25)/b16-13- |
| InChIKey | SQBSTBFGLWGEKQ-SSZFMOIBSA-N |
| XLogP | 5.50 |
| TPSA | 68.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 397.50 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze (Z)-4-(1,3-benzothiazol-2-yl)-5-(3-methoxy-4-propoxyphenyl)pent-4-enoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z)-4-(1,3-benzothiazol-2-yl)-5-(3-methoxy-4-propoxyphenyl)pent-4-enoic acid?
The IUPAC name of (Z)-4-(1,3-benzothiazol-2-yl)-5-(3-methoxy-4-propoxyphenyl)pent-4-enoic acid (CID 92945343) is (Z)-4-(1,3-benzothiazol-2-yl)-5-(3-methoxy-4-propoxyphenyl)pent-4-enoic acid.
What is the SMILES notation for (Z)-4-(1,3-benzothiazol-2-yl)-5-(3-methoxy-4-propoxyphenyl)pent-4-enoic acid?
The canonical SMILES for (Z)-4-(1,3-benzothiazol-2-yl)-5-(3-methoxy-4-propoxyphenyl)pent-4-enoic acid is CCCOc1ccc(/C=C(/CCC(=O)O)c2nc3ccccc3s2)cc1OC.
What is the InChIKey of (Z)-4-(1,3-benzothiazol-2-yl)-5-(3-methoxy-4-propoxyphenyl)pent-4-enoic acid?
The InChIKey is SQBSTBFGLWGEKQ-SSZFMOIBSA-N. The full InChI is InChI=1S/C22H23NO4S/c1-3-12-27-18-10-8-15(14-19(18)26-2)13-16(9-11-21(24)25)22-23-17-6-4-5-7-20(17)28-22/h4-8,10,13-14H,3,9,11-12H2,1-2H3,(H,24,25)/b16-13-.
What are the key properties of (Z)-4-(1,3-benzothiazol-2-yl)-5-(3-methoxy-4-propoxyphenyl)pent-4-enoic acid?
(Z)-4-(1,3-benzothiazol-2-yl)-5-(3-methoxy-4-propoxyphenyl)pent-4-enoic acid has a molecular weight of 397.50 g/mol, XLogP of 5.50, 9 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-4-(1,3-benzothiazol-2-yl)-5-(3-methoxy-4-propoxyphenyl)pent-4-enoic acid is sourced from PubChem (CID 92945343), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).