C21H21NO5S — CID 6224052
(E)-4-(1,3-benzothiazol-2-yl)-5-(2,4,5-trimethoxyphenyl)pent-4-enoic acid (PubChem CID 6224052) has the molecular formula C21H21NO5S and a molecular weight of 399.47 g/mol. Its IUPAC name is (E)-4-(1,3-benzothiazol-2-yl)-5-(2,4,5-trimethoxyphenyl)pent-4-enoic acid.
| Compound Name | (E)-4-(1,3-benzothiazol-2-yl)-5-(2,4,5-trimethoxyphenyl)pent-4-enoic acid |
|---|---|
| PubChem CID | 6224052 |
| Molecular Formula | C21H21NO5S |
| Molecular Weight | 399.47 g/mol |
| Exact Mass | 399.11 |
| IUPAC Name | (E)-4-(1,3-benzothiazol-2-yl)-5-(2,4,5-trimethoxyphenyl)pent-4-enoic acid |
| SMILES | COc1cc(OC)c(OC)cc1/C=C(\CCC(=O)O)c1nc2ccccc2s1 |
| InChI | InChI=1S/C21H21NO5S/c1-25-16-12-18(27-3)17(26-2)11-14(16)10-13(8-9-20(23)24)21-22-15-6-4-5-7-19(15)28-21/h4-7,10-12H,8-9H2,1-3H3,(H,23,24)/b13-10+ |
| InChIKey | NAYPUNSHGPNWDK-JLHYYAGUSA-N |
| XLogP | 4.73 |
| TPSA | 77.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.47 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |