C14H11N3O2S2 — CID 94061389
(E)-4-(1,3-benzothiazol-2-yl)-5-(thiadiazol-4-yl)pent-4-enoic acid (PubChem CID 94061389) has the molecular formula C14H11N3O2S2 and a molecular weight of 317.40 g/mol. Its IUPAC name is (E)-4-(1,3-benzothiazol-2-yl)-5-(thiadiazol-4-yl)pent-4-enoic acid.
| Compound Name | (E)-4-(1,3-benzothiazol-2-yl)-5-(thiadiazol-4-yl)pent-4-enoic acid |
|---|---|
| PubChem CID | 94061389 |
| Molecular Formula | C14H11N3O2S2 |
| Molecular Weight | 317.40 g/mol |
| Exact Mass | 317.03 |
| IUPAC Name | (E)-4-(1,3-benzothiazol-2-yl)-5-(thiadiazol-4-yl)pent-4-enoic acid |
| SMILES | O=C(O)CC/C(=C\c1csnn1)c1nc2ccccc2s1 |
| InChI | InChI=1S/C14H11N3O2S2/c18-13(19)6-5-9(7-10-8-20-17-16-10)14-15-11-3-1-2-4-12(11)21-14/h1-4,7-8H,5-6H2,(H,18,19)/b9-7+ |
| InChIKey | PPGSGMLOTZVOOT-VQHVLOKHSA-N |
| XLogP | 3.55 |
| TPSA | 75.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.40 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |