C19H16ClNO2S — CID 18277446
(E)-5-(1,3-benzothiazol-2-yl)-6-(2-chlorophenyl)hex-5-enoic acid (PubChem CID 18277446) has the molecular formula C19H16ClNO2S and a molecular weight of 357.86 g/mol. Its IUPAC name is (E)-5-(1,3-benzothiazol-2-yl)-6-(2-chlorophenyl)hex-5-enoic acid.
| Compound Name | (E)-5-(1,3-benzothiazol-2-yl)-6-(2-chlorophenyl)hex-5-enoic acid |
|---|---|
| PubChem CID | 18277446 |
| Molecular Formula | C19H16ClNO2S |
| Molecular Weight | 357.86 g/mol |
| Exact Mass | 357.06 |
| IUPAC Name | (E)-5-(1,3-benzothiazol-2-yl)-6-(2-chlorophenyl)hex-5-enoic acid |
| SMILES | O=C(O)CCC/C(=C\c1ccccc1Cl)c1nc2ccccc2s1 |
| InChI | InChI=1S/C19H16ClNO2S/c20-15-8-2-1-6-13(15)12-14(7-5-11-18(22)23)19-21-16-9-3-4-10-17(16)24-19/h1-4,6,8-10,12H,5,7,11H2,(H,22,23)/b14-12+ |
| InChIKey | CWNLCROHMFWEGD-WYMLVPIESA-N |
| XLogP | 5.75 |
| TPSA | 50.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.86 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |