C19H14N2O2S — CID 3974081
4-(1,3-benzothiazol-2-yl)-5-(4-cyanophenyl)pent-4-enoic acid (PubChem CID 3974081) has the molecular formula C19H14N2O2S and a molecular weight of 334.40 g/mol. Its IUPAC name is 4-(1,3-benzothiazol-2-yl)-5-(4-cyanophenyl)pent-4-enoic acid.
| Compound Name | 4-(1,3-benzothiazol-2-yl)-5-(4-cyanophenyl)pent-4-enoic acid |
|---|---|
| PubChem CID | 3974081 |
| Molecular Formula | C19H14N2O2S |
| Molecular Weight | 334.40 g/mol |
| Exact Mass | 334.08 |
| IUPAC Name | 4-(1,3-benzothiazol-2-yl)-5-(4-cyanophenyl)pent-4-enoic acid |
| SMILES | N#Cc1ccc(C=C(CCC(=O)O)c2nc3ccccc3s2)cc1 |
| InChI | InChI=1S/C19H14N2O2S/c20-12-14-7-5-13(6-8-14)11-15(9-10-18(22)23)19-21-16-3-1-2-4-17(16)24-19/h1-8,11H,9-10H2,(H,22,23) |
| InChIKey | LKNBEDPLAHSNHY-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 73.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.40 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |