C22H23N2O2S- — CID 7939346
(E)-4-(1,3-benzothiazol-2-yl)-5-[4-(diethylamino)phenyl]pent-4-enoate (PubChem CID 7939346) has the molecular formula C22H23N2O2S- and a molecular weight of 379.51 g/mol. Its IUPAC name is (E)-4-(1,3-benzothiazol-2-yl)-5-[4-(diethylamino)phenyl]pent-4-enoate.
| Compound Name | (E)-4-(1,3-benzothiazol-2-yl)-5-[4-(diethylamino)phenyl]pent-4-enoate |
|---|---|
| PubChem CID | 7939346 |
| Molecular Formula | C22H23N2O2S- |
| Molecular Weight | 379.51 g/mol |
| Exact Mass | 379.15 |
| IUPAC Name | (E)-4-(1,3-benzothiazol-2-yl)-5-[4-(diethylamino)phenyl]pent-4-enoate |
| SMILES | CCN(CC)c1ccc(/C=C(\CCC(=O)[O-])c2nc3ccccc3s2)cc1 |
| InChI | InChI=1S/C22H24N2O2S/c1-3-24(4-2)18-12-9-16(10-13-18)15-17(11-14-21(25)26)22-23-19-7-5-6-8-20(19)27-22/h5-10,12-13,15H,3-4,11,14H2,1-2H3,(H,25,26)/p-1/b17-15+ |
| InChIKey | AHFVXMGYPPLGIL-BMRADRMJSA-M |
| XLogP | 4.21 |
| TPSA | 56.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.51 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'} |
|---|