C19H15N2O4S- — CID 7594316
(E)-4-(1,3-benzothiazol-2-yl)-5-(4-methyl-3-nitrophenyl)pent-4-enoate (PubChem CID 7594316) has the molecular formula C19H15N2O4S- and a molecular weight of 367.41 g/mol. Its IUPAC name is (E)-4-(1,3-benzothiazol-2-yl)-5-(4-methyl-3-nitrophenyl)pent-4-enoate.
| Compound Name | (E)-4-(1,3-benzothiazol-2-yl)-5-(4-methyl-3-nitrophenyl)pent-4-enoate |
|---|---|
| PubChem CID | 7594316 |
| Molecular Formula | C19H15N2O4S- |
| Molecular Weight | 367.41 g/mol |
| Exact Mass | 367.08 |
| IUPAC Name | (E)-4-(1,3-benzothiazol-2-yl)-5-(4-methyl-3-nitrophenyl)pent-4-enoate |
| SMILES | Cc1ccc(/C=C(\CCC(=O)[O-])c2nc3ccccc3s2)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C19H16N2O4S/c1-12-6-7-13(11-16(12)21(24)25)10-14(8-9-18(22)23)19-20-15-4-2-3-5-17(15)26-19/h2-7,10-11H,8-9H2,1H3,(H,22,23)/p-1/b14-10+ |
| InChIKey | XEFQYEIZGTWFCR-GXDHUFHOSA-M |
| XLogP | 3.58 |
| TPSA | 96.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.41 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|