C19H14NO4S- — CID 7810356
(E)-3-(1,3-benzothiazol-2-yl)-4-(4-methoxycarbonylphenyl)but-3-enoate (PubChem CID 7810356) has the molecular formula C19H14NO4S- and a molecular weight of 352.39 g/mol. Its IUPAC name is (E)-3-(1,3-benzothiazol-2-yl)-4-(4-methoxycarbonylphenyl)but-3-enoate.
| Compound Name | (E)-3-(1,3-benzothiazol-2-yl)-4-(4-methoxycarbonylphenyl)but-3-enoate |
|---|---|
| PubChem CID | 7810356 |
| Molecular Formula | C19H14NO4S- |
| Molecular Weight | 352.39 g/mol |
| Exact Mass | 352.06 |
| IUPAC Name | (E)-3-(1,3-benzothiazol-2-yl)-4-(4-methoxycarbonylphenyl)but-3-enoate |
| SMILES | COC(=O)c1ccc(/C=C(\CC(=O)[O-])c2nc3ccccc3s2)cc1 |
| InChI | InChI=1S/C19H15NO4S/c1-24-19(23)13-8-6-12(7-9-13)10-14(11-17(21)22)18-20-15-4-2-3-5-16(15)25-18/h2-10H,11H2,1H3,(H,21,22)/p-1/b14-10+ |
| InChIKey | HMPQDKFMNIOTIO-GXDHUFHOSA-M |
| XLogP | 2.76 |
| TPSA | 79.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.39 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |