C22H13N3O2S2 — CID 3588337
2-[1-(1,3-benzothiazol-2-yl)-2-(4-nitrophenyl)ethenyl]-1,3-benzothiazole (PubChem CID 3588337) has the molecular formula C22H13N3O2S2 and a molecular weight of 415.50 g/mol. Its IUPAC name is 2-[1-(1,3-benzothiazol-2-yl)-2-(4-nitrophenyl)ethenyl]-1,3-benzothiazole.
| Compound Name | 2-[1-(1,3-benzothiazol-2-yl)-2-(4-nitrophenyl)ethenyl]-1,3-benzothiazole |
|---|---|
| PubChem CID | 3588337 |
| Molecular Formula | C22H13N3O2S2 |
| Molecular Weight | 415.50 g/mol |
| Exact Mass | 415.04 |
| IUPAC Name | 2-[1-(1,3-benzothiazol-2-yl)-2-(4-nitrophenyl)ethenyl]-1,3-benzothiazole |
| SMILES | O=[N+]([O-])c1ccc(C=C(c2nc3ccccc3s2)c2nc3ccccc3s2)cc1 |
| InChI | InChI=1S/C22H13N3O2S2/c26-25(27)15-11-9-14(10-12-15)13-16(21-23-17-5-1-3-7-19(17)28-21)22-24-18-6-2-4-8-20(18)29-22/h1-13H |
| InChIKey | NTWRXHSDYIBIDT-UHFFFAOYSA-N |
| XLogP | 6.40 |
| TPSA | 68.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.50 |
| LogP ≤ 5 | 6.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|