C22H13N3O6S — CID 153275100
2-(1,3-benzothiazol-2-yl)-3-hydroxy-1,3-bis(4-nitrophenyl)prop-2-en-1-one (PubChem CID 153275100) has the molecular formula C22H13N3O6S and a molecular weight of 447.43 g/mol. Its IUPAC name is 2-(1,3-benzothiazol-2-yl)-3-hydroxy-1,3-bis(4-nitrophenyl)prop-2-en-1-one.
| Compound Name | 2-(1,3-benzothiazol-2-yl)-3-hydroxy-1,3-bis(4-nitrophenyl)prop-2-en-1-one |
|---|---|
| PubChem CID | 153275100 |
| Molecular Formula | C22H13N3O6S |
| Molecular Weight | 447.43 g/mol |
| Exact Mass | 447.05 |
| IUPAC Name | 2-(1,3-benzothiazol-2-yl)-3-hydroxy-1,3-bis(4-nitrophenyl)prop-2-en-1-one |
| SMILES | O=C(C(=C(O)c1ccc([N+](=O)[O-])cc1)c1nc2ccccc2s1)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C22H13N3O6S/c26-20(13-5-9-15(10-6-13)24(28)29)19(22-23-17-3-1-2-4-18(17)32-22)21(27)14-7-11-16(12-8-14)25(30)31/h1-12,26H |
| InChIKey | WIWJWLXWYBGMEE-UHFFFAOYSA-N |
| XLogP | 5.42 |
| TPSA | 136.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.43 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|