C18H17N3O3S — CID 7733341
N-(1,3-benzothiazol-2-yl)-N-(2-methylpropyl)-4-nitrobenzamide (PubChem CID 7733341) has the molecular formula C18H17N3O3S and a molecular weight of 355.42 g/mol. Its IUPAC name is N-(1,3-benzothiazol-2-yl)-N-(2-methylpropyl)-4-nitrobenzamide.
| Compound Name | N-(1,3-benzothiazol-2-yl)-N-(2-methylpropyl)-4-nitrobenzamide |
|---|---|
| PubChem CID | 7733341 |
| Molecular Formula | C18H17N3O3S |
| Molecular Weight | 355.42 g/mol |
| Exact Mass | 355.10 |
| IUPAC Name | N-(1,3-benzothiazol-2-yl)-N-(2-methylpropyl)-4-nitrobenzamide |
| SMILES | CC(C)CN(C(=O)c1ccc([N+](=O)[O-])cc1)c1nc2ccccc2s1 |
| InChI | InChI=1S/C18H17N3O3S/c1-12(2)11-20(18-19-15-5-3-4-6-16(15)25-18)17(22)13-7-9-14(10-8-13)21(23)24/h3-10,12H,11H2,1-2H3 |
| InChIKey | YVBKSLHVFLHOMB-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 76.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.42 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|