C17H14F2N2O3S2 — CID 18193276
N-(1,3-benzothiazol-2-yl)-4-(difluoromethylsulfonyl)-N-ethylbenzamide (PubChem CID 18193276) has the molecular formula C17H14F2N2O3S2 and a molecular weight of 396.44 g/mol. Its IUPAC name is N-(1,3-benzothiazol-2-yl)-4-(difluoromethylsulfonyl)-N-ethylbenzamide.
| Compound Name | N-(1,3-benzothiazol-2-yl)-4-(difluoromethylsulfonyl)-N-ethylbenzamide |
|---|---|
| PubChem CID | 18193276 |
| Molecular Formula | C17H14F2N2O3S2 |
| Molecular Weight | 396.44 g/mol |
| Exact Mass | 396.04 |
| IUPAC Name | N-(1,3-benzothiazol-2-yl)-4-(difluoromethylsulfonyl)-N-ethylbenzamide |
| SMILES | CCN(C(=O)c1ccc(S(=O)(=O)C(F)F)cc1)c1nc2ccccc2s1 |
| InChI | InChI=1S/C17H14F2N2O3S2/c1-2-21(17-20-13-5-3-4-6-14(13)25-17)15(22)11-7-9-12(10-8-11)26(23,24)16(18)19/h3-10,16H,2H2,1H3 |
| InChIKey | QIFIUHNQOROSAW-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 67.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.44 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |