C19H21N3O3S2 — CID 16600618
N-(1,3-benzothiazol-2-yl)-N-ethyl-4-(propan-2-ylsulfamoyl)benzamide (PubChem CID 16600618) has the molecular formula C19H21N3O3S2 and a molecular weight of 403.53 g/mol. Its IUPAC name is N-(1,3-benzothiazol-2-yl)-N-ethyl-4-(propan-2-ylsulfamoyl)benzamide.
| Compound Name | N-(1,3-benzothiazol-2-yl)-N-ethyl-4-(propan-2-ylsulfamoyl)benzamide |
|---|---|
| PubChem CID | 16600618 |
| Molecular Formula | C19H21N3O3S2 |
| Molecular Weight | 403.53 g/mol |
| Exact Mass | 403.10 |
| IUPAC Name | N-(1,3-benzothiazol-2-yl)-N-ethyl-4-(propan-2-ylsulfamoyl)benzamide |
| SMILES | CCN(C(=O)c1ccc(S(=O)(=O)NC(C)C)cc1)c1nc2ccccc2s1 |
| InChI | InChI=1S/C19H21N3O3S2/c1-4-22(19-20-16-7-5-6-8-17(16)26-19)18(23)14-9-11-15(12-10-14)27(24,25)21-13(2)3/h5-13,21H,4H2,1-3H3 |
| InChIKey | JPYLLFVWUDIDHC-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 79.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.53 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |