C25H25N3O4S2 — CID 16597575
N-benzyl-N-(6-methoxy-1,3-benzothiazol-2-yl)-4-(propan-2-ylsulfamoyl)benzamide (PubChem CID 16597575) has the molecular formula C25H25N3O4S2 and a molecular weight of 495.63 g/mol. Its IUPAC name is N-benzyl-N-(6-methoxy-1,3-benzothiazol-2-yl)-4-(propan-2-ylsulfamoyl)benzamide.
| Compound Name | N-benzyl-N-(6-methoxy-1,3-benzothiazol-2-yl)-4-(propan-2-ylsulfamoyl)benzamide |
|---|---|
| PubChem CID | 16597575 |
| Molecular Formula | C25H25N3O4S2 |
| Molecular Weight | 495.63 g/mol |
| Exact Mass | 495.13 |
| IUPAC Name | N-benzyl-N-(6-methoxy-1,3-benzothiazol-2-yl)-4-(propan-2-ylsulfamoyl)benzamide |
| SMILES | COc1ccc2nc(N(Cc3ccccc3)C(=O)c3ccc(S(=O)(=O)NC(C)C)cc3)sc2c1 |
| InChI | InChI=1S/C25H25N3O4S2/c1-17(2)27-34(30,31)21-12-9-19(10-13-21)24(29)28(16-18-7-5-4-6-8-18)25-26-22-14-11-20(32-3)15-23(22)33-25/h4-15,17,27H,16H2,1-3H3 |
| InChIKey | MBYLZDVCGIECRT-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 88.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.63 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |