C27H29N3O4S2 — CID 41110277
N-benzyl-4-(diethylsulfamoyl)-N-(6-ethoxy-1,3-benzothiazol-2-yl)benzamide (PubChem CID 41110277) has the molecular formula C27H29N3O4S2 and a molecular weight of 523.68 g/mol. Its IUPAC name is N-benzyl-4-(diethylsulfamoyl)-N-(6-ethoxy-1,3-benzothiazol-2-yl)benzamide.
| Compound Name | N-benzyl-4-(diethylsulfamoyl)-N-(6-ethoxy-1,3-benzothiazol-2-yl)benzamide |
|---|---|
| PubChem CID | 41110277 |
| Molecular Formula | C27H29N3O4S2 |
| Molecular Weight | 523.68 g/mol |
| Exact Mass | 523.16 |
| IUPAC Name | N-benzyl-4-(diethylsulfamoyl)-N-(6-ethoxy-1,3-benzothiazol-2-yl)benzamide |
| SMILES | CCOc1ccc2nc(N(Cc3ccccc3)C(=O)c3ccc(S(=O)(=O)N(CC)CC)cc3)sc2c1 |
| InChI | InChI=1S/C27H29N3O4S2/c1-4-29(5-2)36(32,33)23-15-12-21(13-16-23)26(31)30(19-20-10-8-7-9-11-20)27-28-24-17-14-22(34-6-3)18-25(24)35-27/h7-18H,4-6,19H2,1-3H3 |
| InChIKey | LXTLSVVJJOAVHA-UHFFFAOYSA-N |
| XLogP | 5.57 |
| TPSA | 79.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.68 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |