C25H25N3O3S2 — CID 41109487
N-(1,3-benzothiazol-2-yl)-N-benzyl-4-(diethylsulfamoyl)benzamide (PubChem CID 41109487) has the molecular formula C25H25N3O3S2 and a molecular weight of 479.63 g/mol. Its IUPAC name is N-(1,3-benzothiazol-2-yl)-N-benzyl-4-(diethylsulfamoyl)benzamide.
| Compound Name | N-(1,3-benzothiazol-2-yl)-N-benzyl-4-(diethylsulfamoyl)benzamide |
|---|---|
| PubChem CID | 41109487 |
| Molecular Formula | C25H25N3O3S2 |
| Molecular Weight | 479.63 g/mol |
| Exact Mass | 479.13 |
| IUPAC Name | N-(1,3-benzothiazol-2-yl)-N-benzyl-4-(diethylsulfamoyl)benzamide |
| SMILES | CCN(CC)S(=O)(=O)c1ccc(C(=O)N(Cc2ccccc2)c2nc3ccccc3s2)cc1 |
| InChI | InChI=1S/C25H25N3O3S2/c1-3-27(4-2)33(30,31)21-16-14-20(15-17-21)24(29)28(18-19-10-6-5-7-11-19)25-26-22-12-8-9-13-23(22)32-25/h5-17H,3-4,18H2,1-2H3 |
| InChIKey | ALEKUGFEEGHGRX-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 70.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.63 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |