C23H21N3OS — CID 8613503
N-(1,3-benzothiazol-2-yl)-N-benzyl-4-(dimethylamino)benzamide (PubChem CID 8613503) has the molecular formula C23H21N3OS and a molecular weight of 387.51 g/mol. Its IUPAC name is N-(1,3-benzothiazol-2-yl)-N-benzyl-4-(dimethylamino)benzamide.
| Compound Name | N-(1,3-benzothiazol-2-yl)-N-benzyl-4-(dimethylamino)benzamide |
|---|---|
| PubChem CID | 8613503 |
| Molecular Formula | C23H21N3OS |
| Molecular Weight | 387.51 g/mol |
| Exact Mass | 387.14 |
| IUPAC Name | N-(1,3-benzothiazol-2-yl)-N-benzyl-4-(dimethylamino)benzamide |
| SMILES | CN(C)c1ccc(C(=O)N(Cc2ccccc2)c2nc3ccccc3s2)cc1 |
| InChI | InChI=1S/C23H21N3OS/c1-25(2)19-14-12-18(13-15-19)22(27)26(16-17-8-4-3-5-9-17)23-24-20-10-6-7-11-21(20)28-23/h3-15H,16H2,1-2H3 |
| InChIKey | XGCIOIVGFZFPRX-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 36.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.51 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |