C22H16N2O3S — CID 41106848
N-(1,3-benzothiazol-2-yl)-N-benzyl-1,3-benzodioxole-5-carboxamide (PubChem CID 41106848) has the molecular formula C22H16N2O3S and a molecular weight of 388.45 g/mol. Its IUPAC name is N-(1,3-benzothiazol-2-yl)-N-benzyl-1,3-benzodioxole-5-carboxamide.
| Compound Name | N-(1,3-benzothiazol-2-yl)-N-benzyl-1,3-benzodioxole-5-carboxamide |
|---|---|
| PubChem CID | 41106848 |
| Molecular Formula | C22H16N2O3S |
| Molecular Weight | 388.45 g/mol |
| Exact Mass | 388.09 |
| IUPAC Name | N-(1,3-benzothiazol-2-yl)-N-benzyl-1,3-benzodioxole-5-carboxamide |
| SMILES | O=C(c1ccc2c(c1)OCO2)N(Cc1ccccc1)c1nc2ccccc2s1 |
| InChI | InChI=1S/C22H16N2O3S/c25-21(16-10-11-18-19(12-16)27-14-26-18)24(13-15-6-2-1-3-7-15)22-23-17-8-4-5-9-20(17)28-22/h1-12H,13-14H2 |
| InChIKey | SACVSESAGUYSPZ-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 51.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.45 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |