C21H14ClFN2OS — CID 41110353
N-benzyl-N-(6-chloro-1,3-benzothiazol-2-yl)-4-fluorobenzamide (PubChem CID 41110353) has the molecular formula C21H14ClFN2OS and a molecular weight of 396.87 g/mol. Its IUPAC name is N-benzyl-N-(6-chloro-1,3-benzothiazol-2-yl)-4-fluorobenzamide.
| Compound Name | N-benzyl-N-(6-chloro-1,3-benzothiazol-2-yl)-4-fluorobenzamide |
|---|---|
| PubChem CID | 41110353 |
| Molecular Formula | C21H14ClFN2OS |
| Molecular Weight | 396.87 g/mol |
| Exact Mass | 396.05 |
| IUPAC Name | N-benzyl-N-(6-chloro-1,3-benzothiazol-2-yl)-4-fluorobenzamide |
| SMILES | O=C(c1ccc(F)cc1)N(Cc1ccccc1)c1nc2ccc(Cl)cc2s1 |
| InChI | InChI=1S/C21H14ClFN2OS/c22-16-8-11-18-19(12-16)27-21(24-18)25(13-14-4-2-1-3-5-14)20(26)15-6-9-17(23)10-7-15/h1-12H,13H2 |
| InChIKey | LYSQYFZPYYYTKD-UHFFFAOYSA-N |
| XLogP | 5.94 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.87 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |