C25H24FN3O3S2 — CID 41110417
N-benzyl-4-(diethylsulfamoyl)-N-(6-fluoro-1,3-benzothiazol-2-yl)benzamide (PubChem CID 41110417) has the molecular formula C25H24FN3O3S2 and a molecular weight of 497.62 g/mol. Its IUPAC name is N-benzyl-4-(diethylsulfamoyl)-N-(6-fluoro-1,3-benzothiazol-2-yl)benzamide.
| Compound Name | N-benzyl-4-(diethylsulfamoyl)-N-(6-fluoro-1,3-benzothiazol-2-yl)benzamide |
|---|---|
| PubChem CID | 41110417 |
| Molecular Formula | C25H24FN3O3S2 |
| Molecular Weight | 497.62 g/mol |
| Exact Mass | 497.12 |
| IUPAC Name | N-benzyl-4-(diethylsulfamoyl)-N-(6-fluoro-1,3-benzothiazol-2-yl)benzamide |
| SMILES | CCN(CC)S(=O)(=O)c1ccc(C(=O)N(Cc2ccccc2)c2nc3ccc(F)cc3s2)cc1 |
| InChI | InChI=1S/C25H24FN3O3S2/c1-3-28(4-2)34(31,32)21-13-10-19(11-14-21)24(30)29(17-18-8-6-5-7-9-18)25-27-22-15-12-20(26)16-23(22)33-25/h5-16H,3-4,17H2,1-2H3 |
| InChIKey | XUZMJZOMYIGHAU-UHFFFAOYSA-N |
| XLogP | 5.31 |
| TPSA | 70.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.62 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |