C25H23F2N3O3S2 — CID 41110554
N-benzyl-4-(diethylsulfamoyl)-N-(4,6-difluoro-1,3-benzothiazol-2-yl)benzamide (PubChem CID 41110554) has the molecular formula C25H23F2N3O3S2 and a molecular weight of 515.61 g/mol. Its IUPAC name is N-benzyl-4-(diethylsulfamoyl)-N-(4,6-difluoro-1,3-benzothiazol-2-yl)benzamide.
| Compound Name | N-benzyl-4-(diethylsulfamoyl)-N-(4,6-difluoro-1,3-benzothiazol-2-yl)benzamide |
|---|---|
| PubChem CID | 41110554 |
| Molecular Formula | C25H23F2N3O3S2 |
| Molecular Weight | 515.61 g/mol |
| Exact Mass | 515.11 |
| IUPAC Name | N-benzyl-4-(diethylsulfamoyl)-N-(4,6-difluoro-1,3-benzothiazol-2-yl)benzamide |
| SMILES | CCN(CC)S(=O)(=O)c1ccc(C(=O)N(Cc2ccccc2)c2nc3c(F)cc(F)cc3s2)cc1 |
| InChI | InChI=1S/C25H23F2N3O3S2/c1-3-29(4-2)35(32,33)20-12-10-18(11-13-20)24(31)30(16-17-8-6-5-7-9-17)25-28-23-21(27)14-19(26)15-22(23)34-25/h5-15H,3-4,16H2,1-2H3 |
| InChIKey | YJZFPJLSYRYXAS-UHFFFAOYSA-N |
| XLogP | 5.45 |
| TPSA | 70.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.61 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |