C20H23N3O3S2 — CID 46787802
N-(1,3-benzothiazol-2-ylmethyl)-4-(butan-2-ylsulfamoyl)-N-methylbenzamide (PubChem CID 46787802) has the molecular formula C20H23N3O3S2 and a molecular weight of 417.56 g/mol. Its IUPAC name is N-(1,3-benzothiazol-2-ylmethyl)-4-(butan-2-ylsulfamoyl)-N-methylbenzamide.
| Compound Name | N-(1,3-benzothiazol-2-ylmethyl)-4-(butan-2-ylsulfamoyl)-N-methylbenzamide |
|---|---|
| PubChem CID | 46787802 |
| Molecular Formula | C20H23N3O3S2 |
| Molecular Weight | 417.56 g/mol |
| Exact Mass | 417.12 |
| IUPAC Name | N-(1,3-benzothiazol-2-ylmethyl)-4-(butan-2-ylsulfamoyl)-N-methylbenzamide |
| SMILES | CCC(C)NS(=O)(=O)c1ccc(C(=O)N(C)Cc2nc3ccccc3s2)cc1 |
| InChI | InChI=1S/C20H23N3O3S2/c1-4-14(2)22-28(25,26)16-11-9-15(10-12-16)20(24)23(3)13-19-21-17-7-5-6-8-18(17)27-19/h5-12,14,22H,4,13H2,1-3H3 |
| InChIKey | XRBWVBMXDUYGIO-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 79.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.56 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |