C23H20N2O2S — CID 9392276
N-(1,3-benzothiazol-2-ylmethyl)-N-methyl-4-phenylmethoxybenzamide (PubChem CID 9392276) has the molecular formula C23H20N2O2S and a molecular weight of 388.49 g/mol. Its IUPAC name is N-(1,3-benzothiazol-2-ylmethyl)-N-methyl-4-phenylmethoxybenzamide.
| Compound Name | N-(1,3-benzothiazol-2-ylmethyl)-N-methyl-4-phenylmethoxybenzamide |
|---|---|
| PubChem CID | 9392276 |
| Molecular Formula | C23H20N2O2S |
| Molecular Weight | 388.49 g/mol |
| Exact Mass | 388.12 |
| IUPAC Name | N-(1,3-benzothiazol-2-ylmethyl)-N-methyl-4-phenylmethoxybenzamide |
| SMILES | CN(Cc1nc2ccccc2s1)C(=O)c1ccc(OCc2ccccc2)cc1 |
| InChI | InChI=1S/C23H20N2O2S/c1-25(15-22-24-20-9-5-6-10-21(20)28-22)23(26)18-11-13-19(14-12-18)27-16-17-7-3-2-4-8-17/h2-14H,15-16H2,1H3 |
| InChIKey | BVHABJUEOVCYFH-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 42.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.49 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |