C25H23N3O5S — CID 24538886
2-(1,3-benzothiazol-2-ylmethoxy)-N'-[2-(4-phenylmethoxyphenoxy)acetyl]acetohydrazide (PubChem CID 24538886) has the molecular formula C25H23N3O5S and a molecular weight of 477.54 g/mol. Its IUPAC name is 2-(1,3-benzothiazol-2-ylmethoxy)-N'-[2-(4-phenylmethoxyphenoxy)acetyl]acetohydrazide.
| Compound Name | 2-(1,3-benzothiazol-2-ylmethoxy)-N'-[2-(4-phenylmethoxyphenoxy)acetyl]acetohydrazide |
|---|---|
| PubChem CID | 24538886 |
| Molecular Formula | C25H23N3O5S |
| Molecular Weight | 477.54 g/mol |
| Exact Mass | 477.14 |
| IUPAC Name | 2-(1,3-benzothiazol-2-ylmethoxy)-N'-[2-(4-phenylmethoxyphenoxy)acetyl]acetohydrazide |
| SMILES | O=C(COCc1nc2ccccc2s1)NNC(=O)COc1ccc(OCc2ccccc2)cc1 |
| InChI | InChI=1S/C25H23N3O5S/c29-23(15-31-17-25-26-21-8-4-5-9-22(21)34-25)27-28-24(30)16-33-20-12-10-19(11-13-20)32-14-18-6-2-1-3-7-18/h1-13H,14-17H2,(H,27,29)(H,28,30) |
| InChIKey | AHYVRWPGYILAJF-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 98.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.54 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|