C17H17N3O4S — CID 43049275
N-[2-[[2-(1,3-benzothiazol-2-ylmethoxy)acetyl]amino]ethyl]furan-2-carboxamide (PubChem CID 43049275) has the molecular formula C17H17N3O4S and a molecular weight of 359.41 g/mol. Its IUPAC name is N-[2-[[2-(1,3-benzothiazol-2-ylmethoxy)acetyl]amino]ethyl]furan-2-carboxamide.
| Compound Name | N-[2-[[2-(1,3-benzothiazol-2-ylmethoxy)acetyl]amino]ethyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 43049275 |
| Molecular Formula | C17H17N3O4S |
| Molecular Weight | 359.41 g/mol |
| Exact Mass | 359.09 |
| IUPAC Name | N-[2-[[2-(1,3-benzothiazol-2-ylmethoxy)acetyl]amino]ethyl]furan-2-carboxamide |
| SMILES | O=C(COCc1nc2ccccc2s1)NCCNC(=O)c1ccco1 |
| InChI | InChI=1S/C17H17N3O4S/c21-15(18-7-8-19-17(22)13-5-3-9-24-13)10-23-11-16-20-12-4-1-2-6-14(12)25-16/h1-6,9H,7-8,10-11H2,(H,18,21)(H,19,22) |
| InChIKey | FUWLWKRXANJRFL-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 93.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.41 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|