C20H21N3O4S — CID 9324359
2-(1,3-benzothiazol-2-ylmethoxy)-N'-[2-(4-ethylphenoxy)acetyl]acetohydrazide (PubChem CID 9324359) has the molecular formula C20H21N3O4S and a molecular weight of 399.47 g/mol. Its IUPAC name is 2-(1,3-benzothiazol-2-ylmethoxy)-N'-[2-(4-ethylphenoxy)acetyl]acetohydrazide.
| Compound Name | 2-(1,3-benzothiazol-2-ylmethoxy)-N'-[2-(4-ethylphenoxy)acetyl]acetohydrazide |
|---|---|
| PubChem CID | 9324359 |
| Molecular Formula | C20H21N3O4S |
| Molecular Weight | 399.47 g/mol |
| Exact Mass | 399.13 |
| IUPAC Name | 2-(1,3-benzothiazol-2-ylmethoxy)-N'-[2-(4-ethylphenoxy)acetyl]acetohydrazide |
| SMILES | CCc1ccc(OCC(=O)NNC(=O)COCc2nc3ccccc3s2)cc1 |
| InChI | InChI=1S/C20H21N3O4S/c1-2-14-7-9-15(10-8-14)27-12-19(25)23-22-18(24)11-26-13-20-21-16-5-3-4-6-17(16)28-20/h3-10H,2,11-13H2,1H3,(H,22,24)(H,23,25) |
| InChIKey | ZJMHYYTYSIUOGT-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 89.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.47 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|