C16H12F2N2OS — CID 30797487
N-(1,3-benzothiazol-2-yl)-N-ethyl-2,6-difluorobenzamide (PubChem CID 30797487) has the molecular formula C16H12F2N2OS and a molecular weight of 318.35 g/mol. Its IUPAC name is N-(1,3-benzothiazol-2-yl)-N-ethyl-2,6-difluorobenzamide.
| Compound Name | N-(1,3-benzothiazol-2-yl)-N-ethyl-2,6-difluorobenzamide |
|---|---|
| PubChem CID | 30797487 |
| Molecular Formula | C16H12F2N2OS |
| Molecular Weight | 318.35 g/mol |
| Exact Mass | 318.06 |
| IUPAC Name | N-(1,3-benzothiazol-2-yl)-N-ethyl-2,6-difluorobenzamide |
| SMILES | CCN(C(=O)c1c(F)cccc1F)c1nc2ccccc2s1 |
| InChI | InChI=1S/C16H12F2N2OS/c1-2-20(15(21)14-10(17)6-5-7-11(14)18)16-19-12-8-3-4-9-13(12)22-16/h3-9H,2H2,1H3 |
| InChIKey | KRJHTDQOKCDLRX-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.35 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |