C15H9Cl4N3OS — CID 16559914
N-(1,3-benzothiazol-2-yl)-3,4,5,6-tetrachloro-N-ethylpyridine-2-carboxamide (PubChem CID 16559914) has the molecular formula C15H9Cl4N3OS and a molecular weight of 421.14 g/mol. Its IUPAC name is N-(1,3-benzothiazol-2-yl)-3,4,5,6-tetrachloro-N-ethylpyridine-2-carboxamide.
| Compound Name | N-(1,3-benzothiazol-2-yl)-3,4,5,6-tetrachloro-N-ethylpyridine-2-carboxamide |
|---|---|
| PubChem CID | 16559914 |
| Molecular Formula | C15H9Cl4N3OS |
| Molecular Weight | 421.14 g/mol |
| Exact Mass | 418.92 |
| IUPAC Name | N-(1,3-benzothiazol-2-yl)-3,4,5,6-tetrachloro-N-ethylpyridine-2-carboxamide |
| SMILES | CCN(C(=O)c1nc(Cl)c(Cl)c(Cl)c1Cl)c1nc2ccccc2s1 |
| InChI | InChI=1S/C15H9Cl4N3OS/c1-2-22(15-20-7-5-3-4-6-8(7)24-15)14(23)12-10(17)9(16)11(18)13(19)21-12/h3-6H,2H2,1H3 |
| InChIKey | LWDLJBOWHMBEEW-UHFFFAOYSA-N |
| XLogP | 5.97 |
| TPSA | 46.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.14 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|