C16H12ClFN2OS — CID 34189759
N-(1,3-benzothiazol-2-yl)-2-chloro-N-ethyl-4-fluorobenzamide (PubChem CID 34189759) has the molecular formula C16H12ClFN2OS and a molecular weight of 334.80 g/mol. Its IUPAC name is N-(1,3-benzothiazol-2-yl)-2-chloro-N-ethyl-4-fluorobenzamide.
| Compound Name | N-(1,3-benzothiazol-2-yl)-2-chloro-N-ethyl-4-fluorobenzamide |
|---|---|
| PubChem CID | 34189759 |
| Molecular Formula | C16H12ClFN2OS |
| Molecular Weight | 334.80 g/mol |
| Exact Mass | 334.03 |
| IUPAC Name | N-(1,3-benzothiazol-2-yl)-2-chloro-N-ethyl-4-fluorobenzamide |
| SMILES | CCN(C(=O)c1ccc(F)cc1Cl)c1nc2ccccc2s1 |
| InChI | InChI=1S/C16H12ClFN2OS/c1-2-20(15(21)11-8-7-10(18)9-12(11)17)16-19-13-5-3-4-6-14(13)22-16/h3-9H,2H2,1H3 |
| InChIKey | RKEPSZRINQZKIO-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.80 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |