C29H19NO3S — CID 6522349
[(Z)-2-(1,3-benzothiazol-2-yl)-3-oxo-1,3-diphenylprop-1-enyl] benzoate (PubChem CID 6522349) has the molecular formula C29H19NO3S and a molecular weight of 461.54 g/mol. Its IUPAC name is [(Z)-2-(1,3-benzothiazol-2-yl)-3-oxo-1,3-diphenylprop-1-enyl] benzoate.
| Compound Name | [(Z)-2-(1,3-benzothiazol-2-yl)-3-oxo-1,3-diphenylprop-1-enyl] benzoate |
|---|---|
| PubChem CID | 6522349 |
| Molecular Formula | C29H19NO3S |
| Molecular Weight | 461.54 g/mol |
| Exact Mass | 461.11 |
| IUPAC Name | [(Z)-2-(1,3-benzothiazol-2-yl)-3-oxo-1,3-diphenylprop-1-enyl] benzoate |
| SMILES | O=C(O/C(=C(/C(=O)c1ccccc1)c1nc2ccccc2s1)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C29H19NO3S/c31-26(20-12-4-1-5-13-20)25(28-30-23-18-10-11-19-24(23)34-28)27(21-14-6-2-7-15-21)33-29(32)22-16-8-3-9-17-22/h1-19H/b27-25- |
| InChIKey | HLMBALKKCNUCKR-RFBIWTDZSA-N |
| XLogP | 6.90 |
| TPSA | 56.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.54 |
| LogP ≤ 5 | 6.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|