C22H12N2O4S2 — CID 66591523
bis(1,3-benzothiazol-2-yl) benzene-1,3-dicarboxylate (PubChem CID 66591523) has the molecular formula C22H12N2O4S2 and a molecular weight of 432.48 g/mol. Its IUPAC name is bis(1,3-benzothiazol-2-yl) benzene-1,3-dicarboxylate.
| Compound Name | bis(1,3-benzothiazol-2-yl) benzene-1,3-dicarboxylate |
|---|---|
| PubChem CID | 66591523 |
| Molecular Formula | C22H12N2O4S2 |
| Molecular Weight | 432.48 g/mol |
| Exact Mass | 432.02 |
| IUPAC Name | bis(1,3-benzothiazol-2-yl) benzene-1,3-dicarboxylate |
| SMILES | O=C(Oc1nc2ccccc2s1)c1cccc(C(=O)Oc2nc3ccccc3s2)c1 |
| InChI | InChI=1S/C22H12N2O4S2/c25-19(27-21-23-15-8-1-3-10-17(15)29-21)13-6-5-7-14(12-13)20(26)28-22-24-16-9-2-4-11-18(16)30-22/h1-12H |
| InChIKey | KHXXVLXPONONRC-UHFFFAOYSA-N |
| XLogP | 5.34 |
| TPSA | 78.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.48 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |