C43H28N2O4S2 — CID 169290014
[2,7-bis(1,3-benzothiazol-2-yl)-6-benzoyloxy-9,9-dimethylfluoren-3-yl] benzoate (PubChem CID 169290014) has the molecular formula C43H28N2O4S2 and a molecular weight of 700.84 g/mol. Its IUPAC name is [2,7-bis(1,3-benzothiazol-2-yl)-6-benzoyloxy-9,9-dimethylfluoren-3-yl] benzoate.
| Compound Name | [2,7-bis(1,3-benzothiazol-2-yl)-6-benzoyloxy-9,9-dimethylfluoren-3-yl] benzoate |
|---|---|
| PubChem CID | 169290014 |
| Molecular Formula | C43H28N2O4S2 |
| Molecular Weight | 700.84 g/mol |
| Exact Mass | 700.15 |
| IUPAC Name | [2,7-bis(1,3-benzothiazol-2-yl)-6-benzoyloxy-9,9-dimethylfluoren-3-yl] benzoate |
| SMILES | CC1(C)c2cc(-c3nc4ccccc4s3)c(OC(=O)c3ccccc3)cc2-c2cc(OC(=O)c3ccccc3)c(-c3nc4ccccc4s3)cc21 |
| InChI | InChI=1S/C43H28N2O4S2/c1-43(2)31-21-29(39-44-33-17-9-11-19-37(33)50-39)35(48-41(46)25-13-5-3-6-14-25)23-27(31)28-24-36(49-42(47)26-15-7-4-8-16-26)30(22-32(28)43)40-45-34-18-10-12-20-38(34)51-40/h3-24H,1-2H3 |
| InChIKey | IFVGKQWVBVRLTI-UHFFFAOYSA-N |
| XLogP | 10.98 |
| TPSA | 78.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 700.84 |
| LogP ≤ 5 | 10.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|