C29H22N2O3S — CID 3544974
[2-(1,3-benzothiazol-2-yl)-5-[(3-methylbenzoyl)amino]phenyl] 3-methylbenzoate (PubChem CID 3544974) has the molecular formula C29H22N2O3S and a molecular weight of 478.57 g/mol. Its IUPAC name is [2-(1,3-benzothiazol-2-yl)-5-[(3-methylbenzoyl)amino]phenyl] 3-methylbenzoate.
| Compound Name | [2-(1,3-benzothiazol-2-yl)-5-[(3-methylbenzoyl)amino]phenyl] 3-methylbenzoate |
|---|---|
| PubChem CID | 3544974 |
| Molecular Formula | C29H22N2O3S |
| Molecular Weight | 478.57 g/mol |
| Exact Mass | 478.14 |
| IUPAC Name | [2-(1,3-benzothiazol-2-yl)-5-[(3-methylbenzoyl)amino]phenyl] 3-methylbenzoate |
| SMILES | Cc1cccc(C(=O)Nc2ccc(-c3nc4ccccc4s3)c(OC(=O)c3cccc(C)c3)c2)c1 |
| InChI | InChI=1S/C29H22N2O3S/c1-18-7-5-9-20(15-18)27(32)30-22-13-14-23(28-31-24-11-3-4-12-26(24)35-28)25(17-22)34-29(33)21-10-6-8-19(2)16-21/h3-17H,1-2H3,(H,30,32) |
| InChIKey | SBVKJZTXXXGPFV-UHFFFAOYSA-N |
| XLogP | 7.05 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.57 |
| LogP ≤ 5 | 7.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|