C28H29FN2O5S — CID 70896939
N-[4-(1,3-benzothiazol-2-yl)-3-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]phenyl]-4-fluoro-3-methylbenzamide (PubChem CID 70896939) has the molecular formula C28H29FN2O5S and a molecular weight of 524.61 g/mol. Its IUPAC name is N-[4-(1,3-benzothiazol-2-yl)-3-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]phenyl]-4-fluoro-3-methylbenzamide.
| Compound Name | N-[4-(1,3-benzothiazol-2-yl)-3-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]phenyl]-4-fluoro-3-methylbenzamide |
|---|---|
| PubChem CID | 70896939 |
| Molecular Formula | C28H29FN2O5S |
| Molecular Weight | 524.61 g/mol |
| Exact Mass | 524.18 |
| IUPAC Name | N-[4-(1,3-benzothiazol-2-yl)-3-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]phenyl]-4-fluoro-3-methylbenzamide |
| SMILES | COCCOCCOCCOc1cc(NC(=O)c2ccc(F)c(C)c2)ccc1-c1nc2ccccc2s1 |
| InChI | InChI=1S/C28H29FN2O5S/c1-19-17-20(7-10-23(19)29)27(32)30-21-8-9-22(28-31-24-5-3-4-6-26(24)37-28)25(18-21)36-16-15-35-14-13-34-12-11-33-2/h3-10,17-18H,11-16H2,1-2H3,(H,30,32) |
| InChIKey | GBBNQNTWYBWBDE-UHFFFAOYSA-N |
| XLogP | 5.72 |
| TPSA | 78.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.61 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|