C22H18N2O2S — CID 46364016
N-[4-(1,3-benzothiazol-2-yl)-3-methylphenyl]-3-methoxybenzamide (PubChem CID 46364016) has the molecular formula C22H18N2O2S and a molecular weight of 374.47 g/mol. Its IUPAC name is N-[4-(1,3-benzothiazol-2-yl)-3-methylphenyl]-3-methoxybenzamide.
| Compound Name | N-[4-(1,3-benzothiazol-2-yl)-3-methylphenyl]-3-methoxybenzamide |
|---|---|
| PubChem CID | 46364016 |
| Molecular Formula | C22H18N2O2S |
| Molecular Weight | 374.47 g/mol |
| Exact Mass | 374.11 |
| IUPAC Name | N-[4-(1,3-benzothiazol-2-yl)-3-methylphenyl]-3-methoxybenzamide |
| SMILES | COc1cccc(C(=O)Nc2ccc(-c3nc4ccccc4s3)c(C)c2)c1 |
| InChI | InChI=1S/C22H18N2O2S/c1-14-12-16(23-21(25)15-6-5-7-17(13-15)26-2)10-11-18(14)22-24-19-8-3-4-9-20(19)27-22/h3-13H,1-2H3,(H,23,25) |
| InChIKey | FKAJOODQDOPURO-UHFFFAOYSA-N |
| XLogP | 5.53 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.47 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |