2-[5-acetamido-2-(1,3-benzothiazol-2-yl)phenoxy]acetic acid

C17H14N2O4S — CID 28692152

IUPAC2-[5-acetamido-2-(1,3-benzothiazol-2-yl)phenoxy]acetic acid
SMILESCC(=O)Nc1ccc(-c2nc3ccccc3s2)c(OCC(=O)O)c1
InChIInChI=1S/C17H14N2O4S/c1-10(20)18-11-6-7-12(14(8-11)23-9-16(21)22)17-19-13-4-2-3-5-15(13)24-17/h2-8H,9H2,1H3,(H,18,20)(H,21,22)
InChIKeyWXANGNXFKVUTNA-UHFFFAOYSA-N
MW342.38 g/mol
LogP3.39
Rot. Bonds5

About 2-[5-acetamido-2-(1,3-benzothiazol-2-yl)phenoxy]acetic acid

2-[5-acetamido-2-(1,3-benzothiazol-2-yl)phenoxy]acetic acid (PubChem CID 28692152) has the molecular formula C17H14N2O4S and a molecular weight of 342.38 g/mol. Its IUPAC name is 2-[5-acetamido-2-(1,3-benzothiazol-2-yl)phenoxy]acetic acid.

Molecular Properties

Compound Name2-[5-acetamido-2-(1,3-benzothiazol-2-yl)phenoxy]acetic acid
PubChem CID28692152
Molecular FormulaC17H14N2O4S
Molecular Weight342.38 g/mol
Exact Mass342.07
IUPAC Name2-[5-acetamido-2-(1,3-benzothiazol-2-yl)phenoxy]acetic acid
SMILESCC(=O)Nc1ccc(-c2nc3ccccc3s2)c(OCC(=O)O)c1
InChIInChI=1S/C17H14N2O4S/c1-10(20)18-11-6-7-12(14(8-11)23-9-16(21)22)17-19-13-4-2-3-5-15(13)24-17/h2-8H,9H2,1H3,(H,18,20)(H,21,22)
InChIKeyWXANGNXFKVUTNA-UHFFFAOYSA-N
XLogP3.39
TPSA88.52 Ų
H-Bond Donors2
H-Bond Acceptors5
Rotatable Bonds5
Heavy Atoms24
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500342.38
LogP ≤ 53.39
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 105

Analyze 2-[5-acetamido-2-(1,3-benzothiazol-2-yl)phenoxy]acetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-[5-acetamido-2-(1,3-benzothiazol-2-yl)phenoxy]acetic acid?
The IUPAC name of 2-[5-acetamido-2-(1,3-benzothiazol-2-yl)phenoxy]acetic acid (CID 28692152) is 2-[5-acetamido-2-(1,3-benzothiazol-2-yl)phenoxy]acetic acid.
What is the SMILES notation for 2-[5-acetamido-2-(1,3-benzothiazol-2-yl)phenoxy]acetic acid?
The canonical SMILES for 2-[5-acetamido-2-(1,3-benzothiazol-2-yl)phenoxy]acetic acid is CC(=O)Nc1ccc(-c2nc3ccccc3s2)c(OCC(=O)O)c1.
What is the InChIKey of 2-[5-acetamido-2-(1,3-benzothiazol-2-yl)phenoxy]acetic acid?
The InChIKey is WXANGNXFKVUTNA-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H14N2O4S/c1-10(20)18-11-6-7-12(14(8-11)23-9-16(21)22)17-19-13-4-2-3-5-15(13)24-17/h2-8H,9H2,1H3,(H,18,20)(H,21,22).
What are the key properties of 2-[5-acetamido-2-(1,3-benzothiazol-2-yl)phenoxy]acetic acid?
2-[5-acetamido-2-(1,3-benzothiazol-2-yl)phenoxy]acetic acid has a molecular weight of 342.38 g/mol, XLogP of 3.39, 5 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[5-acetamido-2-(1,3-benzothiazol-2-yl)phenoxy]acetic acid is sourced from PubChem (CID 28692152), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).