C17H14N2O4S — CID 28692152
2-[5-acetamido-2-(1,3-benzothiazol-2-yl)phenoxy]acetic acid (PubChem CID 28692152) has the molecular formula C17H14N2O4S and a molecular weight of 342.38 g/mol. Its IUPAC name is 2-[5-acetamido-2-(1,3-benzothiazol-2-yl)phenoxy]acetic acid.
| Compound Name | 2-[5-acetamido-2-(1,3-benzothiazol-2-yl)phenoxy]acetic acid |
|---|---|
| PubChem CID | 28692152 |
| Molecular Formula | C17H14N2O4S |
| Molecular Weight | 342.38 g/mol |
| Exact Mass | 342.07 |
| IUPAC Name | 2-[5-acetamido-2-(1,3-benzothiazol-2-yl)phenoxy]acetic acid |
| SMILES | CC(=O)Nc1ccc(-c2nc3ccccc3s2)c(OCC(=O)O)c1 |
| InChI | InChI=1S/C17H14N2O4S/c1-10(20)18-11-6-7-12(14(8-11)23-9-16(21)22)17-19-13-4-2-3-5-15(13)24-17/h2-8H,9H2,1H3,(H,18,20)(H,21,22) |
| InChIKey | WXANGNXFKVUTNA-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 88.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.38 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |