C22H18ClN3O2S — CID 50824816
1-[4-(1,3-benzothiazol-2-yl)-3-chlorophenyl]-3-(2-ethoxyphenyl)urea (PubChem CID 50824816) has the molecular formula C22H18ClN3O2S and a molecular weight of 423.93 g/mol. Its IUPAC name is 1-[4-(1,3-benzothiazol-2-yl)-3-chlorophenyl]-3-(2-ethoxyphenyl)urea.
| Compound Name | 1-[4-(1,3-benzothiazol-2-yl)-3-chlorophenyl]-3-(2-ethoxyphenyl)urea |
|---|---|
| PubChem CID | 50824816 |
| Molecular Formula | C22H18ClN3O2S |
| Molecular Weight | 423.93 g/mol |
| Exact Mass | 423.08 |
| IUPAC Name | 1-[4-(1,3-benzothiazol-2-yl)-3-chlorophenyl]-3-(2-ethoxyphenyl)urea |
| SMILES | CCOc1ccccc1NC(=O)Nc1ccc(-c2nc3ccccc3s2)c(Cl)c1 |
| InChI | InChI=1S/C22H18ClN3O2S/c1-2-28-19-9-5-3-7-17(19)26-22(27)24-14-11-12-15(16(23)13-14)21-25-18-8-4-6-10-20(18)29-21/h3-13H,2H2,1H3,(H2,24,26,27) |
| InChIKey | ZJYRYKFYIUKFIZ-UHFFFAOYSA-N |
| XLogP | 6.66 |
| TPSA | 63.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.93 |
| LogP ≤ 5 | 6.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |