C20H12ClF2N3OS — CID 46381187
1-[4-(1,3-benzothiazol-2-yl)-3-chlorophenyl]-3-(2,5-difluorophenyl)urea (PubChem CID 46381187) has the molecular formula C20H12ClF2N3OS and a molecular weight of 415.85 g/mol. Its IUPAC name is 1-[4-(1,3-benzothiazol-2-yl)-3-chlorophenyl]-3-(2,5-difluorophenyl)urea.
| Compound Name | 1-[4-(1,3-benzothiazol-2-yl)-3-chlorophenyl]-3-(2,5-difluorophenyl)urea |
|---|---|
| PubChem CID | 46381187 |
| Molecular Formula | C20H12ClF2N3OS |
| Molecular Weight | 415.85 g/mol |
| Exact Mass | 415.04 |
| IUPAC Name | 1-[4-(1,3-benzothiazol-2-yl)-3-chlorophenyl]-3-(2,5-difluorophenyl)urea |
| SMILES | O=C(Nc1ccc(-c2nc3ccccc3s2)c(Cl)c1)Nc1cc(F)ccc1F |
| InChI | InChI=1S/C20H12ClF2N3OS/c21-14-10-12(24-20(27)26-17-9-11(22)5-8-15(17)23)6-7-13(14)19-25-16-3-1-2-4-18(16)28-19/h1-10H,(H2,24,26,27) |
| InChIKey | OIEUPJWNUOANDE-UHFFFAOYSA-N |
| XLogP | 6.54 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.85 |
| LogP ≤ 5 | 6.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |