C18H10N2O4S2 — CID 174377758
bis(1,3-benzothiazol-2-yl) (E)-but-2-enedioate (PubChem CID 174377758) has the molecular formula C18H10N2O4S2 and a molecular weight of 382.42 g/mol. Its IUPAC name is bis(1,3-benzothiazol-2-yl) (E)-but-2-enedioate.
| Compound Name | bis(1,3-benzothiazol-2-yl) (E)-but-2-enedioate |
|---|---|
| PubChem CID | 174377758 |
| Molecular Formula | C18H10N2O4S2 |
| Molecular Weight | 382.42 g/mol |
| Exact Mass | 382.01 |
| IUPAC Name | bis(1,3-benzothiazol-2-yl) (E)-but-2-enedioate |
| SMILES | O=C(/C=C/C(=O)Oc1nc2ccccc2s1)Oc1nc2ccccc2s1 |
| InChI | InChI=1S/C18H10N2O4S2/c21-15(23-17-19-11-5-1-3-7-13(11)25-17)9-10-16(22)24-18-20-12-6-2-4-8-14(12)26-18/h1-10H/b10-9+ |
| InChIKey | IZUOKKMEXIZVIW-MDZDMXLPSA-N |
| XLogP | 3.97 |
| TPSA | 78.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.42 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|